C19H31IN6O4 — CID 111329021
ethyl 4-[[N-ethyl-N'-[2-(2-nitroanilino)ethyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide (PubChem CID 111329021) has the molecular formula C19H31IN6O4 and a molecular weight of 534.40 g/mol. Its IUPAC name is ethyl 4-[[N-ethyl-N'-[2-(2-nitroanilino)ethyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[[N-ethyl-N'-[2-(2-nitroanilino)ethyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111329021 |
| Molecular Formula | C19H31IN6O4 |
| Molecular Weight | 534.40 g/mol |
| Exact Mass | 534.15 |
| IUPAC Name | ethyl 4-[[N-ethyl-N'-[2-(2-nitroanilino)ethyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\CCNc1ccccc1[N+](=O)[O-])NC1CCN(C(=O)OCC)CC1.I |
| InChI | InChI=1S/C19H30N6O4.HI/c1-3-20-18(23-15-9-13-24(14-10-15)19(26)29-4-2)22-12-11-21-16-7-5-6-8-17(16)25(27)28;/h5-8,15,21H,3-4,9-14H2,1-2H3,(H2,20,22,23);1H |
| InChIKey | PRLPUTQXIYTTGC-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.40 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|