C19H30F3IN6O2 — CID 111329029
ethyl 4-[[N-ethyl-N'-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide (PubChem CID 111329029) has the molecular formula C19H30F3IN6O2 and a molecular weight of 558.39 g/mol. Its IUPAC name is ethyl 4-[[N-ethyl-N'-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[[N-ethyl-N'-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111329029 |
| Molecular Formula | C19H30F3IN6O2 |
| Molecular Weight | 558.39 g/mol |
| Exact Mass | 558.14 |
| IUPAC Name | ethyl 4-[[N-ethyl-N'-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\CCNc1ncccc1C(F)(F)F)NC1CCN(C(=O)OCC)CC1.I |
| InChI | InChI=1S/C19H29F3N6O2.HI/c1-3-23-17(27-14-7-12-28(13-8-14)18(29)30-4-2)26-11-10-25-16-15(19(20,21)22)6-5-9-24-16;/h5-6,9,14H,3-4,7-8,10-13H2,1-2H3,(H,24,25)(H2,23,26,27);1H |
| InChIKey | VRIBETJNPACBKK-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.39 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|