C14H18F3N5 — CID 136921909
1-ethyl-3-prop-2-ynyl-2-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]guanidine (PubChem CID 136921909) has the molecular formula C14H18F3N5 and a molecular weight of 313.33 g/mol. Its IUPAC name is 1-ethyl-3-prop-2-ynyl-2-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]guanidine.
| Compound Name | 1-ethyl-3-prop-2-ynyl-2-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]guanidine |
|---|---|
| PubChem CID | 136921909 |
| Molecular Formula | C14H18F3N5 |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 1-ethyl-3-prop-2-ynyl-2-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]guanidine |
| SMILES | C#CCN/C(=N/CCNc1ncccc1C(F)(F)F)NCC |
| InChI | InChI=1S/C14H18F3N5/c1-3-7-21-13(18-4-2)22-10-9-20-12-11(14(15,16)17)6-5-8-19-12/h1,5-6,8H,4,7,9-10H2,2H3,(H,19,20)(H2,18,21,22) |
| InChIKey | GQQPCGXZPZCJEF-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 61.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|