C17H24F3IN6S — CID 111534697
1-ethyl-2-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]guanidine;hydroiodide (PubChem CID 111534697) has the molecular formula C17H24F3IN6S and a molecular weight of 528.39 g/mol. Its IUPAC name is 1-ethyl-2-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111534697 |
| Molecular Formula | C17H24F3IN6S |
| Molecular Weight | 528.39 g/mol |
| Exact Mass | 528.08 |
| IUPAC Name | 1-ethyl-2-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ncc(CC)s1)NCCNc1ncccc1C(F)(F)F.I |
| InChI | InChI=1S/C17H23F3N6S.HI/c1-3-12-10-25-14(27-12)11-26-16(21-4-2)24-9-8-23-15-13(17(18,19)20)6-5-7-22-15;/h5-7,10H,3-4,8-9,11H2,1-2H3,(H,22,23)(H2,21,24,26);1H |
| InChIKey | WUFHDTVFMCSQRS-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 74.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.39 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|