C22H27F3IN7 — CID 111850973
1-ethyl-2-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]-3-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]guanidine;hydroiodide (PubChem CID 111850973) has the molecular formula C22H27F3IN7 and a molecular weight of 573.41 g/mol. Its IUPAC name is 1-ethyl-2-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]-3-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]-3-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111850973 |
| Molecular Formula | C22H27F3IN7 |
| Molecular Weight | 573.41 g/mol |
| Exact Mass | 573.13 |
| IUPAC Name | 1-ethyl-2-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]-3-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccc1Cn1cccn1)NCCNc1ncccc1C(F)(F)F.I |
| InChI | InChI=1S/C22H26F3N7.HI/c1-2-26-21(29-13-12-28-20-19(22(23,24)25)9-5-10-27-20)30-15-17-7-3-4-8-18(17)16-32-14-6-11-31-32;/h3-11,14H,2,12-13,15-16H2,1H3,(H,27,28)(H2,26,29,30);1H |
| InChIKey | ZBSZSMGBZQLZTF-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 79.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.41 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|