C16H21F3IN5O — CID 110937755
1-ethyl-2-(furan-2-ylmethyl)-3-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]guanidine;hydroiodide (PubChem CID 110937755) has the molecular formula C16H21F3IN5O and a molecular weight of 483.28 g/mol. Its IUPAC name is 1-ethyl-2-(furan-2-ylmethyl)-3-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-(furan-2-ylmethyl)-3-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110937755 |
| Molecular Formula | C16H21F3IN5O |
| Molecular Weight | 483.28 g/mol |
| Exact Mass | 483.07 |
| IUPAC Name | 1-ethyl-2-(furan-2-ylmethyl)-3-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccco1)NCCNc1ncccc1C(F)(F)F.I |
| InChI | InChI=1S/C16H20F3N5O.HI/c1-2-20-15(24-11-12-5-4-10-25-12)23-9-8-22-14-13(16(17,18)19)6-3-7-21-14;/h3-7,10H,2,8-9,11H2,1H3,(H,21,22)(H2,20,23,24);1H |
| InChIKey | SFTBJWOGXLXQHG-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 74.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.28 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|