C18H32F3IN6O — CID 111650669
1-ethyl-2-[2-[3-methoxypropyl(methyl)amino]ethyl]-3-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]guanidine;hydroiodide (PubChem CID 111650669) has the molecular formula C18H32F3IN6O and a molecular weight of 532.39 g/mol. Its IUPAC name is 1-ethyl-2-[2-[3-methoxypropyl(methyl)amino]ethyl]-3-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[2-[3-methoxypropyl(methyl)amino]ethyl]-3-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111650669 |
| Molecular Formula | C18H32F3IN6O |
| Molecular Weight | 532.39 g/mol |
| Exact Mass | 532.16 |
| IUPAC Name | 1-ethyl-2-[2-[3-methoxypropyl(methyl)amino]ethyl]-3-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCN(C)CCCOC)NCCNc1ncccc1C(F)(F)F.I |
| InChI | InChI=1S/C18H31F3N6O.HI/c1-4-22-17(26-11-13-27(2)12-6-14-28-3)25-10-9-24-16-15(18(19,20)21)7-5-8-23-16;/h5,7-8H,4,6,9-14H2,1-3H3,(H,23,24)(H2,22,25,26);1H |
| InChIKey | DQLWWRSPWPRIPX-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 73.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.39 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|