C17H22F3N5S — CID 111350514
1-ethyl-2-(2-thiophen-2-ylethyl)-3-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]guanidine (PubChem CID 111350514) has the molecular formula C17H22F3N5S and a molecular weight of 385.46 g/mol. Its IUPAC name is 1-ethyl-2-(2-thiophen-2-ylethyl)-3-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]guanidine.
| Compound Name | 1-ethyl-2-(2-thiophen-2-ylethyl)-3-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]guanidine |
|---|---|
| PubChem CID | 111350514 |
| Molecular Formula | C17H22F3N5S |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | 1-ethyl-2-(2-thiophen-2-ylethyl)-3-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]guanidine |
| SMILES | CCN/C(=N\CCc1cccs1)NCCNc1ncccc1C(F)(F)F |
| InChI | InChI=1S/C17H22F3N5S/c1-2-21-16(24-9-7-13-5-4-12-26-13)25-11-10-23-15-14(17(18,19)20)6-3-8-22-15/h3-6,8,12H,2,7,9-11H2,1H3,(H,22,23)(H2,21,24,25) |
| InChIKey | KTGDHYGCHRDUKD-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 61.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|