C14H14F3N3OS — CID 51090526
2-thiophen-2-yl-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]acetamide (PubChem CID 51090526) has the molecular formula C14H14F3N3OS and a molecular weight of 329.35 g/mol. Its IUPAC name is 2-thiophen-2-yl-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]acetamide.
| Compound Name | 2-thiophen-2-yl-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 51090526 |
| Molecular Formula | C14H14F3N3OS |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 2-thiophen-2-yl-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]acetamide |
| SMILES | O=C(Cc1cccs1)NCCNc1ncccc1C(F)(F)F |
| InChI | InChI=1S/C14H14F3N3OS/c15-14(16,17)11-4-1-5-19-13(11)20-7-6-18-12(21)9-10-3-2-8-22-10/h1-5,8H,6-7,9H2,(H,18,21)(H,19,20) |
| InChIKey | MQVTXDZCWUFNKW-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|