C11H10N2O2S — CID 110462769
N-(3-hydroxy-2-pyridinyl)-2-thiophen-2-ylacetamide (PubChem CID 110462769) has the molecular formula C11H10N2O2S and a molecular weight of 234.28 g/mol. Its IUPAC name is N-(3-hydroxy-2-pyridinyl)-2-thiophen-2-ylacetamide.
| Compound Name | N-(3-hydroxy-2-pyridinyl)-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 110462769 |
| Molecular Formula | C11H10N2O2S |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | N-(3-hydroxy-2-pyridinyl)-2-thiophen-2-ylacetamide |
| SMILES | O=C(Cc1cccs1)Nc1ncccc1O |
| InChI | InChI=1S/C11H10N2O2S/c14-9-4-1-5-12-11(9)13-10(15)7-8-3-2-6-16-8/h1-6,14H,7H2,(H,12,13,15) |
| InChIKey | DHSDQEIXHUOULF-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |