C12H8ClF3N2OS — CID 4188468
N-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2-thiophen-2-ylacetamide (PubChem CID 4188468) has the molecular formula C12H8ClF3N2OS and a molecular weight of 320.72 g/mol. Its IUPAC name is N-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 4188468 |
| Molecular Formula | C12H8ClF3N2OS |
| Molecular Weight | 320.72 g/mol |
| Exact Mass | 320.00 |
| IUPAC Name | N-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2-thiophen-2-ylacetamide |
| SMILES | O=C(Cc1cccs1)Nc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C12H8ClF3N2OS/c13-9-4-7(12(14,15)16)6-17-11(9)18-10(19)5-8-2-1-3-20-8/h1-4,6H,5H2,(H,17,18,19) |
| InChIKey | KJQLKGKCLYBSEL-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.72 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |