C15H9ClF4N2O3 — CID 2385544
[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-2-oxoethyl] 3-fluorobenzoate (PubChem CID 2385544) has the molecular formula C15H9ClF4N2O3 and a molecular weight of 376.69 g/mol. Its IUPAC name is [2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-2-oxoethyl] 3-fluorobenzoate.
| Compound Name | [2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-2-oxoethyl] 3-fluorobenzoate |
|---|---|
| PubChem CID | 2385544 |
| Molecular Formula | C15H9ClF4N2O3 |
| Molecular Weight | 376.69 g/mol |
| Exact Mass | 376.02 |
| IUPAC Name | [2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-2-oxoethyl] 3-fluorobenzoate |
| SMILES | O=C(COC(=O)c1cccc(F)c1)Nc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C15H9ClF4N2O3/c16-11-5-9(15(18,19)20)6-21-13(11)22-12(23)7-25-14(24)8-2-1-3-10(17)4-8/h1-6H,7H2,(H,21,22,23) |
| InChIKey | PDZLEYWGXCHUFX-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.69 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |