C16H9ClF3N3O3 — CID 4102499
[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-2-oxoethyl] 4-cyanobenzoate (PubChem CID 4102499) has the molecular formula C16H9ClF3N3O3 and a molecular weight of 383.71 g/mol. Its IUPAC name is [2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-2-oxoethyl] 4-cyanobenzoate.
| Compound Name | [2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-2-oxoethyl] 4-cyanobenzoate |
|---|---|
| PubChem CID | 4102499 |
| Molecular Formula | C16H9ClF3N3O3 |
| Molecular Weight | 383.71 g/mol |
| Exact Mass | 383.03 |
| IUPAC Name | [2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-2-oxoethyl] 4-cyanobenzoate |
| SMILES | N#Cc1ccc(C(=O)OCC(=O)Nc2ncc(C(F)(F)F)cc2Cl)cc1 |
| InChI | InChI=1S/C16H9ClF3N3O3/c17-12-5-11(16(18,19)20)7-22-14(12)23-13(24)8-26-15(25)10-3-1-9(6-21)2-4-10/h1-5,7H,8H2,(H,22,23,24) |
| InChIKey | POBBHAGXHYEUSZ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.71 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |