C15H9Cl2N3O3 — CID 2626390
[2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 3-cyanobenzoate (PubChem CID 2626390) has the molecular formula C15H9Cl2N3O3 and a molecular weight of 350.16 g/mol. Its IUPAC name is [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 3-cyanobenzoate.
| Compound Name | [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 3-cyanobenzoate |
|---|---|
| PubChem CID | 2626390 |
| Molecular Formula | C15H9Cl2N3O3 |
| Molecular Weight | 350.16 g/mol |
| Exact Mass | 349.00 |
| IUPAC Name | [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 3-cyanobenzoate |
| SMILES | N#Cc1cccc(C(=O)OCC(=O)Nc2ncc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C15H9Cl2N3O3/c16-11-5-12(17)14(19-7-11)20-13(21)8-23-15(22)10-3-1-2-9(4-10)6-18/h1-5,7H,8H2,(H,19,20,21) |
| InChIKey | RQNRVTHGIXFXID-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.16 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |