C13H7Cl4N3O3 — CID 2373927
[2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 5,6-dichloropyridine-3-carboxylate (PubChem CID 2373927) has the molecular formula C13H7Cl4N3O3 and a molecular weight of 395.03 g/mol. Its IUPAC name is [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 5,6-dichloropyridine-3-carboxylate.
| Compound Name | [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 5,6-dichloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 2373927 |
| Molecular Formula | C13H7Cl4N3O3 |
| Molecular Weight | 395.03 g/mol |
| Exact Mass | 392.92 |
| IUPAC Name | [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 5,6-dichloropyridine-3-carboxylate |
| SMILES | O=C(COC(=O)c1cnc(Cl)c(Cl)c1)Nc1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C13H7Cl4N3O3/c14-7-2-9(16)12(19-4-7)20-10(21)5-23-13(22)6-1-8(15)11(17)18-3-6/h1-4H,5H2,(H,19,20,21) |
| InChIKey | MKTRFMWBGAECTR-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.03 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|