C14H10Cl3N3O3 — CID 4531982
[2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 3-amino-4-chlorobenzoate (PubChem CID 4531982) has the molecular formula C14H10Cl3N3O3 and a molecular weight of 374.61 g/mol. Its IUPAC name is [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 3-amino-4-chlorobenzoate.
| Compound Name | [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 3-amino-4-chlorobenzoate |
|---|---|
| PubChem CID | 4531982 |
| Molecular Formula | C14H10Cl3N3O3 |
| Molecular Weight | 374.61 g/mol |
| Exact Mass | 372.98 |
| IUPAC Name | [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 3-amino-4-chlorobenzoate |
| SMILES | Nc1cc(C(=O)OCC(=O)Nc2ncc(Cl)cc2Cl)ccc1Cl |
| InChI | InChI=1S/C14H10Cl3N3O3/c15-8-4-10(17)13(19-5-8)20-12(21)6-23-14(22)7-1-2-9(16)11(18)3-7/h1-5H,6,18H2,(H,19,20,21) |
| InChIKey | JGNNAMIAFIXENH-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.61 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|