C15H10Cl4N2O3 — CID 7764963
[2-oxo-2-(2,4,6-trichloroanilino)ethyl] 3-amino-4-chlorobenzoate (PubChem CID 7764963) has the molecular formula C15H10Cl4N2O3 and a molecular weight of 408.07 g/mol. Its IUPAC name is [2-oxo-2-(2,4,6-trichloroanilino)ethyl] 3-amino-4-chlorobenzoate.
| Compound Name | [2-oxo-2-(2,4,6-trichloroanilino)ethyl] 3-amino-4-chlorobenzoate |
|---|---|
| PubChem CID | 7764963 |
| Molecular Formula | C15H10Cl4N2O3 |
| Molecular Weight | 408.07 g/mol |
| Exact Mass | 405.94 |
| IUPAC Name | [2-oxo-2-(2,4,6-trichloroanilino)ethyl] 3-amino-4-chlorobenzoate |
| SMILES | Nc1cc(C(=O)OCC(=O)Nc2c(Cl)cc(Cl)cc2Cl)ccc1Cl |
| InChI | InChI=1S/C15H10Cl4N2O3/c16-8-4-10(18)14(11(19)5-8)21-13(22)6-24-15(23)7-1-2-9(17)12(20)3-7/h1-5H,6,20H2,(H,21,22) |
| InChIKey | VZLZTTCQAFUUSR-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.07 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|