C15H10Cl3NO4 — CID 2624996
[2-oxo-2-(2,4,6-trichloroanilino)ethyl] 4-hydroxybenzoate (PubChem CID 2624996) has the molecular formula C15H10Cl3NO4 and a molecular weight of 374.61 g/mol. Its IUPAC name is [2-oxo-2-(2,4,6-trichloroanilino)ethyl] 4-hydroxybenzoate.
| Compound Name | [2-oxo-2-(2,4,6-trichloroanilino)ethyl] 4-hydroxybenzoate |
|---|---|
| PubChem CID | 2624996 |
| Molecular Formula | C15H10Cl3NO4 |
| Molecular Weight | 374.61 g/mol |
| Exact Mass | 372.97 |
| IUPAC Name | [2-oxo-2-(2,4,6-trichloroanilino)ethyl] 4-hydroxybenzoate |
| SMILES | O=C(COC(=O)c1ccc(O)cc1)Nc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C15H10Cl3NO4/c16-9-5-11(17)14(12(18)6-9)19-13(21)7-23-15(22)8-1-3-10(20)4-2-8/h1-6,20H,7H2,(H,19,21) |
| InChIKey | QSLXHDXMHHFBRG-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.61 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |