methyl 4-[2-oxo-2-(2,4,6-trichloroanilino)ethoxy]benzoate

C16H12Cl3NO4 — CID 7667580

IUPACmethyl 4-[2-oxo-2-(2,4,6-trichloroanilino)ethoxy]benzoate
SMILESCOC(=O)c1ccc(OCC(=O)Nc2c(Cl)cc(Cl)cc2Cl)cc1
InChIInChI=1S/C16H12Cl3NO4/c1-23-16(22)9-2-4-11(5-3-9)24-8-14(21)20-15-12(18)6-10(17)7-13(15)19/h2-7H,8H2,1H3,(H,20,21)
InChIKeyCCQFXTXBERLMSC-UHFFFAOYSA-N
MW388.63 g/mol
LogP4.45
Rot. Bonds5

About methyl 4-[2-oxo-2-(2,4,6-trichloroanilino)ethoxy]benzoate

methyl 4-[2-oxo-2-(2,4,6-trichloroanilino)ethoxy]benzoate (PubChem CID 7667580) has the molecular formula C16H12Cl3NO4 and a molecular weight of 388.63 g/mol. Its IUPAC name is methyl 4-[2-oxo-2-(2,4,6-trichloroanilino)ethoxy]benzoate.

Molecular Properties

Compound Namemethyl 4-[2-oxo-2-(2,4,6-trichloroanilino)ethoxy]benzoate
PubChem CID7667580
Molecular FormulaC16H12Cl3NO4
Molecular Weight388.63 g/mol
Exact Mass386.98
IUPAC Namemethyl 4-[2-oxo-2-(2,4,6-trichloroanilino)ethoxy]benzoate
SMILESCOC(=O)c1ccc(OCC(=O)Nc2c(Cl)cc(Cl)cc2Cl)cc1
InChIInChI=1S/C16H12Cl3NO4/c1-23-16(22)9-2-4-11(5-3-9)24-8-14(21)20-15-12(18)6-10(17)7-13(15)19/h2-7H,8H2,1H3,(H,20,21)
InChIKeyCCQFXTXBERLMSC-UHFFFAOYSA-N
XLogP4.45
TPSA64.63 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500388.63
LogP ≤ 54.45
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 4-[2-oxo-2-(2,4,6-trichloroanilino)ethoxy]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-[2-oxo-2-(2,4,6-trichloroanilino)ethoxy]benzoate?
The IUPAC name of methyl 4-[2-oxo-2-(2,4,6-trichloroanilino)ethoxy]benzoate (CID 7667580) is methyl 4-[2-oxo-2-(2,4,6-trichloroanilino)ethoxy]benzoate.
What is the SMILES notation for methyl 4-[2-oxo-2-(2,4,6-trichloroanilino)ethoxy]benzoate?
The canonical SMILES for methyl 4-[2-oxo-2-(2,4,6-trichloroanilino)ethoxy]benzoate is COC(=O)c1ccc(OCC(=O)Nc2c(Cl)cc(Cl)cc2Cl)cc1.
What is the InChIKey of methyl 4-[2-oxo-2-(2,4,6-trichloroanilino)ethoxy]benzoate?
The InChIKey is CCQFXTXBERLMSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12Cl3NO4/c1-23-16(22)9-2-4-11(5-3-9)24-8-14(21)20-15-12(18)6-10(17)7-13(15)19/h2-7H,8H2,1H3,(H,20,21).
What are the key properties of methyl 4-[2-oxo-2-(2,4,6-trichloroanilino)ethoxy]benzoate?
methyl 4-[2-oxo-2-(2,4,6-trichloroanilino)ethoxy]benzoate has a molecular weight of 388.63 g/mol, XLogP of 4.45, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[2-oxo-2-(2,4,6-trichloroanilino)ethoxy]benzoate is sourced from PubChem (CID 7667580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).