C16H12Cl3NO4 — CID 7667580
methyl 4-[2-oxo-2-(2,4,6-trichloroanilino)ethoxy]benzoate (PubChem CID 7667580) has the molecular formula C16H12Cl3NO4 and a molecular weight of 388.63 g/mol. Its IUPAC name is methyl 4-[2-oxo-2-(2,4,6-trichloroanilino)ethoxy]benzoate.
| Compound Name | methyl 4-[2-oxo-2-(2,4,6-trichloroanilino)ethoxy]benzoate |
|---|---|
| PubChem CID | 7667580 |
| Molecular Formula | C16H12Cl3NO4 |
| Molecular Weight | 388.63 g/mol |
| Exact Mass | 386.98 |
| IUPAC Name | methyl 4-[2-oxo-2-(2,4,6-trichloroanilino)ethoxy]benzoate |
| SMILES | COC(=O)c1ccc(OCC(=O)Nc2c(Cl)cc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C16H12Cl3NO4/c1-23-16(22)9-2-4-11(5-3-9)24-8-14(21)20-15-12(18)6-10(17)7-13(15)19/h2-7H,8H2,1H3,(H,20,21) |
| InChIKey | CCQFXTXBERLMSC-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.63 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |