C17H10Cl3NO4 — CID 7233718
2-(2-oxochromen-7-yl)oxy-N-(2,4,6-trichlorophenyl)acetamide (PubChem CID 7233718) has the molecular formula C17H10Cl3NO4 and a molecular weight of 398.63 g/mol. Its IUPAC name is 2-(2-oxochromen-7-yl)oxy-N-(2,4,6-trichlorophenyl)acetamide.
| Compound Name | 2-(2-oxochromen-7-yl)oxy-N-(2,4,6-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 7233718 |
| Molecular Formula | C17H10Cl3NO4 |
| Molecular Weight | 398.63 g/mol |
| Exact Mass | 396.97 |
| IUPAC Name | 2-(2-oxochromen-7-yl)oxy-N-(2,4,6-trichlorophenyl)acetamide |
| SMILES | O=C(COc1ccc2ccc(=O)oc2c1)Nc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C17H10Cl3NO4/c18-10-5-12(19)17(13(20)6-10)21-15(22)8-24-11-3-1-9-2-4-16(23)25-14(9)7-11/h1-7H,8H2,(H,21,22) |
| InChIKey | JUPFKGQTRRKOOP-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.63 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|