C19H16ClNO4 — CID 7565223
N-[(1R)-1-(2-chlorophenyl)ethyl]-2-(2-oxochromen-7-yl)oxyacetamide (PubChem CID 7565223) has the molecular formula C19H16ClNO4 and a molecular weight of 357.79 g/mol. Its IUPAC name is N-[(1R)-1-(2-chlorophenyl)ethyl]-2-(2-oxochromen-7-yl)oxyacetamide.
| Compound Name | N-[(1R)-1-(2-chlorophenyl)ethyl]-2-(2-oxochromen-7-yl)oxyacetamide |
|---|---|
| PubChem CID | 7565223 |
| Molecular Formula | C19H16ClNO4 |
| Molecular Weight | 357.79 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | N-[(1R)-1-(2-chlorophenyl)ethyl]-2-(2-oxochromen-7-yl)oxyacetamide |
| SMILES | C[C@@H](NC(=O)COc1ccc2ccc(=O)oc2c1)c1ccccc1Cl |
| InChI | InChI=1S/C19H16ClNO4/c1-12(15-4-2-3-5-16(15)20)21-18(22)11-24-14-8-6-13-7-9-19(23)25-17(13)10-14/h2-10,12H,11H2,1H3,(H,21,22)/t12-/m1/s1 |
| InChIKey | FIONNHKFBCUSAW-GFCCVEGCSA-N |
| XLogP | 3.70 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.79 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|