C18H13F2NO5 — CID 2705048
N-[4-(difluoromethoxy)phenyl]-2-(2-oxochromen-7-yl)oxyacetamide (PubChem CID 2705048) has the molecular formula C18H13F2NO5 and a molecular weight of 361.30 g/mol. Its IUPAC name is N-[4-(difluoromethoxy)phenyl]-2-(2-oxochromen-7-yl)oxyacetamide.
| Compound Name | N-[4-(difluoromethoxy)phenyl]-2-(2-oxochromen-7-yl)oxyacetamide |
|---|---|
| PubChem CID | 2705048 |
| Molecular Formula | C18H13F2NO5 |
| Molecular Weight | 361.30 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | N-[4-(difluoromethoxy)phenyl]-2-(2-oxochromen-7-yl)oxyacetamide |
| SMILES | O=C(COc1ccc2ccc(=O)oc2c1)Nc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C18H13F2NO5/c19-18(20)25-13-6-3-12(4-7-13)21-16(22)10-24-14-5-1-11-2-8-17(23)26-15(11)9-14/h1-9,18H,10H2,(H,21,22) |
| InChIKey | SZAJIOZSKACMQP-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.30 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|