C19H13F2NO6 — CID 46808974
[2-(3,5-difluoroanilino)-2-oxoethyl] 2-(2-oxochromen-7-yl)oxyacetate (PubChem CID 46808974) has the molecular formula C19H13F2NO6 and a molecular weight of 389.31 g/mol. Its IUPAC name is [2-(3,5-difluoroanilino)-2-oxoethyl] 2-(2-oxochromen-7-yl)oxyacetate.
| Compound Name | [2-(3,5-difluoroanilino)-2-oxoethyl] 2-(2-oxochromen-7-yl)oxyacetate |
|---|---|
| PubChem CID | 46808974 |
| Molecular Formula | C19H13F2NO6 |
| Molecular Weight | 389.31 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | [2-(3,5-difluoroanilino)-2-oxoethyl] 2-(2-oxochromen-7-yl)oxyacetate |
| SMILES | O=C(COC(=O)COc1ccc2ccc(=O)oc2c1)Nc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C19H13F2NO6/c20-12-5-13(21)7-14(6-12)22-17(23)9-27-19(25)10-26-15-3-1-11-2-4-18(24)28-16(11)8-15/h1-8H,9-10H2,(H,22,23) |
| InChIKey | HCYHMEUTCOYFIP-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.31 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|