C20H17NO6S — CID 55468723
[2-(4-methylsulfanylanilino)-2-oxoethyl] 2-(2-oxochromen-7-yl)oxyacetate (PubChem CID 55468723) has the molecular formula C20H17NO6S and a molecular weight of 399.42 g/mol. Its IUPAC name is [2-(4-methylsulfanylanilino)-2-oxoethyl] 2-(2-oxochromen-7-yl)oxyacetate.
| Compound Name | [2-(4-methylsulfanylanilino)-2-oxoethyl] 2-(2-oxochromen-7-yl)oxyacetate |
|---|---|
| PubChem CID | 55468723 |
| Molecular Formula | C20H17NO6S |
| Molecular Weight | 399.42 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | [2-(4-methylsulfanylanilino)-2-oxoethyl] 2-(2-oxochromen-7-yl)oxyacetate |
| SMILES | CSc1ccc(NC(=O)COC(=O)COc2ccc3ccc(=O)oc3c2)cc1 |
| InChI | InChI=1S/C20H17NO6S/c1-28-16-7-4-14(5-8-16)21-18(22)11-26-20(24)12-25-15-6-2-13-3-9-19(23)27-17(13)10-15/h2-10H,11-12H2,1H3,(H,21,22) |
| InChIKey | RVRONYNLIDPCLH-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.42 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|