C22H22N2O5 — CID 7565046
N,N-diethyl-4-[[2-(2-oxochromen-7-yl)oxyacetyl]amino]benzamide (PubChem CID 7565046) has the molecular formula C22H22N2O5 and a molecular weight of 394.43 g/mol. Its IUPAC name is N,N-diethyl-4-[[2-(2-oxochromen-7-yl)oxyacetyl]amino]benzamide.
| Compound Name | N,N-diethyl-4-[[2-(2-oxochromen-7-yl)oxyacetyl]amino]benzamide |
|---|---|
| PubChem CID | 7565046 |
| Molecular Formula | C22H22N2O5 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | N,N-diethyl-4-[[2-(2-oxochromen-7-yl)oxyacetyl]amino]benzamide |
| SMILES | CCN(CC)C(=O)c1ccc(NC(=O)COc2ccc3ccc(=O)oc3c2)cc1 |
| InChI | InChI=1S/C22H22N2O5/c1-3-24(4-2)22(27)16-5-9-17(10-6-16)23-20(25)14-28-18-11-7-15-8-12-21(26)29-19(15)13-18/h5-13H,3-4,14H2,1-2H3,(H,23,25) |
| InChIKey | ISLZYSJFQLTAMY-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|