C22H21NO5 — CID 7432101
2,2-dimethyl-N-[4-[2-(2-oxochromen-7-yl)oxyacetyl]phenyl]propanamide (PubChem CID 7432101) has the molecular formula C22H21NO5 and a molecular weight of 379.41 g/mol. Its IUPAC name is 2,2-dimethyl-N-[4-[2-(2-oxochromen-7-yl)oxyacetyl]phenyl]propanamide.
| Compound Name | 2,2-dimethyl-N-[4-[2-(2-oxochromen-7-yl)oxyacetyl]phenyl]propanamide |
|---|---|
| PubChem CID | 7432101 |
| Molecular Formula | C22H21NO5 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 2,2-dimethyl-N-[4-[2-(2-oxochromen-7-yl)oxyacetyl]phenyl]propanamide |
| SMILES | CC(C)(C)C(=O)Nc1ccc(C(=O)COc2ccc3ccc(=O)oc3c2)cc1 |
| InChI | InChI=1S/C22H21NO5/c1-22(2,3)21(26)23-16-8-4-14(5-9-16)18(24)13-27-17-10-6-15-7-11-20(25)28-19(15)12-17/h4-12H,13H2,1-3H3,(H,23,26) |
| InChIKey | MIHVOQWQSBTVAB-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|