C25H25NO7 — CID 55355911
[1-[4-(2,2-dimethylpropanoylamino)phenyl]-1-oxopropan-2-yl] 2-(2-oxochromen-7-yl)oxyacetate (PubChem CID 55355911) has the molecular formula C25H25NO7 and a molecular weight of 451.48 g/mol. Its IUPAC name is [1-[4-(2,2-dimethylpropanoylamino)phenyl]-1-oxopropan-2-yl] 2-(2-oxochromen-7-yl)oxyacetate.
| Compound Name | [1-[4-(2,2-dimethylpropanoylamino)phenyl]-1-oxopropan-2-yl] 2-(2-oxochromen-7-yl)oxyacetate |
|---|---|
| PubChem CID | 55355911 |
| Molecular Formula | C25H25NO7 |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | [1-[4-(2,2-dimethylpropanoylamino)phenyl]-1-oxopropan-2-yl] 2-(2-oxochromen-7-yl)oxyacetate |
| SMILES | CC(OC(=O)COc1ccc2ccc(=O)oc2c1)C(=O)c1ccc(NC(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C25H25NO7/c1-15(23(29)17-5-9-18(10-6-17)26-24(30)25(2,3)4)32-22(28)14-31-19-11-7-16-8-12-21(27)33-20(16)13-19/h5-13,15H,14H2,1-4H3,(H,26,30) |
| InChIKey | SGMHSUBBYFPIFE-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|