C21H21ClN2O6S — CID 55340959
N-[4-chloro-3-(diethylsulfamoyl)phenyl]-2-(2-oxochromen-7-yl)oxyacetamide (PubChem CID 55340959) has the molecular formula C21H21ClN2O6S and a molecular weight of 464.93 g/mol. Its IUPAC name is N-[4-chloro-3-(diethylsulfamoyl)phenyl]-2-(2-oxochromen-7-yl)oxyacetamide.
| Compound Name | N-[4-chloro-3-(diethylsulfamoyl)phenyl]-2-(2-oxochromen-7-yl)oxyacetamide |
|---|---|
| PubChem CID | 55340959 |
| Molecular Formula | C21H21ClN2O6S |
| Molecular Weight | 464.93 g/mol |
| Exact Mass | 464.08 |
| IUPAC Name | N-[4-chloro-3-(diethylsulfamoyl)phenyl]-2-(2-oxochromen-7-yl)oxyacetamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(NC(=O)COc2ccc3ccc(=O)oc3c2)ccc1Cl |
| InChI | InChI=1S/C21H21ClN2O6S/c1-3-24(4-2)31(27,28)19-11-15(7-9-17(19)22)23-20(25)13-29-16-8-5-14-6-10-21(26)30-18(14)12-16/h5-12H,3-4,13H2,1-2H3,(H,23,25) |
| InChIKey | SXMPVBSBIYECGY-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.93 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|