C25H22N2O6S — CID 55865739
N-[4-[(2,6-dimethylphenyl)sulfamoyl]phenyl]-2-(2-oxochromen-7-yl)oxyacetamide (PubChem CID 55865739) has the molecular formula C25H22N2O6S and a molecular weight of 478.53 g/mol. Its IUPAC name is N-[4-[(2,6-dimethylphenyl)sulfamoyl]phenyl]-2-(2-oxochromen-7-yl)oxyacetamide.
| Compound Name | N-[4-[(2,6-dimethylphenyl)sulfamoyl]phenyl]-2-(2-oxochromen-7-yl)oxyacetamide |
|---|---|
| PubChem CID | 55865739 |
| Molecular Formula | C25H22N2O6S |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | N-[4-[(2,6-dimethylphenyl)sulfamoyl]phenyl]-2-(2-oxochromen-7-yl)oxyacetamide |
| SMILES | Cc1cccc(C)c1NS(=O)(=O)c1ccc(NC(=O)COc2ccc3ccc(=O)oc3c2)cc1 |
| InChI | InChI=1S/C25H22N2O6S/c1-16-4-3-5-17(2)25(16)27-34(30,31)21-11-8-19(9-12-21)26-23(28)15-32-20-10-6-18-7-13-24(29)33-22(18)14-20/h3-14,27H,15H2,1-2H3,(H,26,28) |
| InChIKey | WIHGQDTXWYVXTE-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|