C23H18N2O6S — CID 46465678
N-[3-(benzenesulfonamido)phenyl]-2-(2-oxochromen-7-yl)oxyacetamide (PubChem CID 46465678) has the molecular formula C23H18N2O6S and a molecular weight of 450.47 g/mol. Its IUPAC name is N-[3-(benzenesulfonamido)phenyl]-2-(2-oxochromen-7-yl)oxyacetamide.
| Compound Name | N-[3-(benzenesulfonamido)phenyl]-2-(2-oxochromen-7-yl)oxyacetamide |
|---|---|
| PubChem CID | 46465678 |
| Molecular Formula | C23H18N2O6S |
| Molecular Weight | 450.47 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | N-[3-(benzenesulfonamido)phenyl]-2-(2-oxochromen-7-yl)oxyacetamide |
| SMILES | O=C(COc1ccc2ccc(=O)oc2c1)Nc1cccc(NS(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C23H18N2O6S/c26-22(15-30-19-11-9-16-10-12-23(27)31-21(16)14-19)24-17-5-4-6-18(13-17)25-32(28,29)20-7-2-1-3-8-20/h1-14,25H,15H2,(H,24,26) |
| InChIKey | YVZGYULJYYXAQC-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.47 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|