C22H21NO6S — CID 46547829
N-(4-cyclopentylsulfonylphenyl)-2-(2-oxochromen-7-yl)oxyacetamide (PubChem CID 46547829) has the molecular formula C22H21NO6S and a molecular weight of 427.48 g/mol. Its IUPAC name is N-(4-cyclopentylsulfonylphenyl)-2-(2-oxochromen-7-yl)oxyacetamide.
| Compound Name | N-(4-cyclopentylsulfonylphenyl)-2-(2-oxochromen-7-yl)oxyacetamide |
|---|---|
| PubChem CID | 46547829 |
| Molecular Formula | C22H21NO6S |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | N-(4-cyclopentylsulfonylphenyl)-2-(2-oxochromen-7-yl)oxyacetamide |
| SMILES | O=C(COc1ccc2ccc(=O)oc2c1)Nc1ccc(S(=O)(=O)C2CCCC2)cc1 |
| InChI | InChI=1S/C22H21NO6S/c24-21(14-28-17-9-5-15-6-12-22(25)29-20(15)13-17)23-16-7-10-19(11-8-16)30(26,27)18-3-1-2-4-18/h5-13,18H,1-4,14H2,(H,23,24) |
| InChIKey | UOHIOLKXRPMJTI-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|