C20H17NO6 — CID 17419486
methyl 2-methyl-6-[[2-(2-oxochromen-7-yl)oxyacetyl]amino]benzoate (PubChem CID 17419486) has the molecular formula C20H17NO6 and a molecular weight of 367.36 g/mol. Its IUPAC name is methyl 2-methyl-6-[[2-(2-oxochromen-7-yl)oxyacetyl]amino]benzoate.
| Compound Name | methyl 2-methyl-6-[[2-(2-oxochromen-7-yl)oxyacetyl]amino]benzoate |
|---|---|
| PubChem CID | 17419486 |
| Molecular Formula | C20H17NO6 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | methyl 2-methyl-6-[[2-(2-oxochromen-7-yl)oxyacetyl]amino]benzoate |
| SMILES | COC(=O)c1c(C)cccc1NC(=O)COc1ccc2ccc(=O)oc2c1 |
| InChI | InChI=1S/C20H17NO6/c1-12-4-3-5-15(19(12)20(24)25-2)21-17(22)11-26-14-8-6-13-7-9-18(23)27-16(13)10-14/h3-10H,11H2,1-2H3,(H,21,22) |
| InChIKey | ZKVGFRQXLSRSTG-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|