C20H19ClN2O6S — CID 3930215
N-[4-chloro-3-(dimethylsulfamoyl)phenyl]-2-(4-methyl-2-oxochromen-7-yl)oxyacetamide (PubChem CID 3930215) has the molecular formula C20H19ClN2O6S and a molecular weight of 450.90 g/mol. Its IUPAC name is N-[4-chloro-3-(dimethylsulfamoyl)phenyl]-2-(4-methyl-2-oxochromen-7-yl)oxyacetamide.
| Compound Name | N-[4-chloro-3-(dimethylsulfamoyl)phenyl]-2-(4-methyl-2-oxochromen-7-yl)oxyacetamide |
|---|---|
| PubChem CID | 3930215 |
| Molecular Formula | C20H19ClN2O6S |
| Molecular Weight | 450.90 g/mol |
| Exact Mass | 450.07 |
| IUPAC Name | N-[4-chloro-3-(dimethylsulfamoyl)phenyl]-2-(4-methyl-2-oxochromen-7-yl)oxyacetamide |
| SMILES | Cc1cc(=O)oc2cc(OCC(=O)Nc3ccc(Cl)c(S(=O)(=O)N(C)C)c3)ccc12 |
| InChI | InChI=1S/C20H19ClN2O6S/c1-12-8-20(25)29-17-10-14(5-6-15(12)17)28-11-19(24)22-13-4-7-16(21)18(9-13)30(26,27)23(2)3/h4-10H,11H2,1-3H3,(H,22,24) |
| InChIKey | BTAQPMIFNCVAIG-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.90 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|