C23H21NO6 — CID 108743056
N-(2,2-dimethyl-4-oxo-3H-chromen-6-yl)-2-(4-methyl-2-oxochromen-7-yl)oxyacetamide (PubChem CID 108743056) has the molecular formula C23H21NO6 and a molecular weight of 407.42 g/mol. Its IUPAC name is N-(2,2-dimethyl-4-oxo-3H-chromen-6-yl)-2-(4-methyl-2-oxochromen-7-yl)oxyacetamide.
| Compound Name | N-(2,2-dimethyl-4-oxo-3H-chromen-6-yl)-2-(4-methyl-2-oxochromen-7-yl)oxyacetamide |
|---|---|
| PubChem CID | 108743056 |
| Molecular Formula | C23H21NO6 |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | N-(2,2-dimethyl-4-oxo-3H-chromen-6-yl)-2-(4-methyl-2-oxochromen-7-yl)oxyacetamide |
| SMILES | Cc1cc(=O)oc2cc(OCC(=O)Nc3ccc4c(c3)C(=O)CC(C)(C)O4)ccc12 |
| InChI | InChI=1S/C23H21NO6/c1-13-8-22(27)29-20-10-15(5-6-16(13)20)28-12-21(26)24-14-4-7-19-17(9-14)18(25)11-23(2,3)30-19/h4-10H,11-12H2,1-3H3,(H,24,26) |
| InChIKey | MDBPWZJFYRXMGA-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|