C26H25NO6 — CID 108734544
6-methyl-1'-[2-(4-methyl-2-oxochromen-7-yl)oxyacetyl]spiro[3H-chromene-2,4'-piperidine]-4-one (PubChem CID 108734544) has the molecular formula C26H25NO6 and a molecular weight of 447.49 g/mol. Its IUPAC name is 6-methyl-1'-[2-(4-methyl-2-oxochromen-7-yl)oxyacetyl]spiro[3H-chromene-2,4'-piperidine]-4-one.
| Compound Name | 6-methyl-1'-[2-(4-methyl-2-oxochromen-7-yl)oxyacetyl]spiro[3H-chromene-2,4'-piperidine]-4-one |
|---|---|
| PubChem CID | 108734544 |
| Molecular Formula | C26H25NO6 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | 6-methyl-1'-[2-(4-methyl-2-oxochromen-7-yl)oxyacetyl]spiro[3H-chromene-2,4'-piperidine]-4-one |
| SMILES | Cc1ccc2c(c1)C(=O)CC1(CCN(C(=O)COc3ccc4c(C)cc(=O)oc4c3)CC1)O2 |
| InChI | InChI=1S/C26H25NO6/c1-16-3-6-22-20(11-16)21(28)14-26(33-22)7-9-27(10-8-26)24(29)15-31-18-4-5-19-17(2)12-25(30)32-23(19)13-18/h3-6,11-13H,7-10,14-15H2,1-2H3 |
| InChIKey | UDTUBNJJGWOPBK-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 86.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|