C31H27NO5 — CID 108730429
4-methyl-7-[2-oxo-2-(6-phenylspiro[chromene-2,4'-piperidine]-1'-yl)ethoxy]chromen-2-one (PubChem CID 108730429) has the molecular formula C31H27NO5 and a molecular weight of 493.56 g/mol. Its IUPAC name is 4-methyl-7-[2-oxo-2-(6-phenylspiro[chromene-2,4'-piperidine]-1'-yl)ethoxy]chromen-2-one.
| Compound Name | 4-methyl-7-[2-oxo-2-(6-phenylspiro[chromene-2,4'-piperidine]-1'-yl)ethoxy]chromen-2-one |
|---|---|
| PubChem CID | 108730429 |
| Molecular Formula | C31H27NO5 |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | 4-methyl-7-[2-oxo-2-(6-phenylspiro[chromene-2,4'-piperidine]-1'-yl)ethoxy]chromen-2-one |
| SMILES | Cc1cc(=O)oc2cc(OCC(=O)N3CCC4(C=Cc5cc(-c6ccccc6)ccc5O4)CC3)ccc12 |
| InChI | InChI=1S/C31H27NO5/c1-21-17-30(34)36-28-19-25(8-9-26(21)28)35-20-29(33)32-15-13-31(14-16-32)12-11-24-18-23(7-10-27(24)37-31)22-5-3-2-4-6-22/h2-12,17-19H,13-16,20H2,1H3 |
| InChIKey | ZJDPFKFSSMCDJW-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|