C30H31N3O5 — CID 3630582
4-methyl-7-[2-[8-(1-methylindole-2-carbonyl)-2,8-diazaspiro[4.5]decan-2-yl]-2-oxoethoxy]chromen-2-one (PubChem CID 3630582) has the molecular formula C30H31N3O5 and a molecular weight of 513.59 g/mol. Its IUPAC name is 4-methyl-7-[2-[8-(1-methylindole-2-carbonyl)-2,8-diazaspiro[4.5]decan-2-yl]-2-oxoethoxy]chromen-2-one.
| Compound Name | 4-methyl-7-[2-[8-(1-methylindole-2-carbonyl)-2,8-diazaspiro[4.5]decan-2-yl]-2-oxoethoxy]chromen-2-one |
|---|---|
| PubChem CID | 3630582 |
| Molecular Formula | C30H31N3O5 |
| Molecular Weight | 513.59 g/mol |
| Exact Mass | 513.23 |
| IUPAC Name | 4-methyl-7-[2-[8-(1-methylindole-2-carbonyl)-2,8-diazaspiro[4.5]decan-2-yl]-2-oxoethoxy]chromen-2-one |
| SMILES | Cc1cc(=O)oc2cc(OCC(=O)N3CCC4(CCN(C(=O)c5cc6ccccc6n5C)CC4)C3)ccc12 |
| InChI | InChI=1S/C30H31N3O5/c1-20-15-28(35)38-26-17-22(7-8-23(20)26)37-18-27(34)33-14-11-30(19-33)9-12-32(13-10-30)29(36)25-16-21-5-3-4-6-24(21)31(25)2/h3-8,15-17H,9-14,18-19H2,1-2H3 |
| InChIKey | RKWDHYLNTNDWBD-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 84.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.59 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|