C27H30N4O4 — CID 74227630
(Z)-3-(furan-2-yl)-N-[2-[8-(1-methylindole-2-carbonyl)-2,8-diazaspiro[4.5]decan-2-yl]-2-oxoethyl]prop-2-enamide (PubChem CID 74227630) has the molecular formula C27H30N4O4 and a molecular weight of 474.56 g/mol. Its IUPAC name is (Z)-3-(furan-2-yl)-N-[2-[8-(1-methylindole-2-carbonyl)-2,8-diazaspiro[4.5]decan-2-yl]-2-oxoethyl]prop-2-enamide.
| Compound Name | (Z)-3-(furan-2-yl)-N-[2-[8-(1-methylindole-2-carbonyl)-2,8-diazaspiro[4.5]decan-2-yl]-2-oxoethyl]prop-2-enamide |
|---|---|
| PubChem CID | 74227630 |
| Molecular Formula | C27H30N4O4 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | (Z)-3-(furan-2-yl)-N-[2-[8-(1-methylindole-2-carbonyl)-2,8-diazaspiro[4.5]decan-2-yl]-2-oxoethyl]prop-2-enamide |
| SMILES | Cn1c(C(=O)N2CCC3(CCN(C(=O)CNC(=O)/C=C\c4ccco4)C3)CC2)cc2ccccc21 |
| InChI | InChI=1S/C27H30N4O4/c1-29-22-7-3-2-5-20(22)17-23(29)26(34)30-13-10-27(11-14-30)12-15-31(19-27)25(33)18-28-24(32)9-8-21-6-4-16-35-21/h2-9,16-17H,10-15,18-19H2,1H3,(H,28,32)/b9-8- |
| InChIKey | WEGCUQBCMLZRIK-HJWRWDBZSA-N |
| XLogP | 3.06 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|