C26H31N3O5 — CID 3507631
3-(furan-2-yl)-N-[2-[8-[2-(3-methoxyphenyl)acetyl]-2,8-diazaspiro[4.5]decan-2-yl]-2-oxoethyl]prop-2-enamide (PubChem CID 3507631) has the molecular formula C26H31N3O5 and a molecular weight of 465.55 g/mol. Its IUPAC name is 3-(furan-2-yl)-N-[2-[8-[2-(3-methoxyphenyl)acetyl]-2,8-diazaspiro[4.5]decan-2-yl]-2-oxoethyl]prop-2-enamide.
| Compound Name | 3-(furan-2-yl)-N-[2-[8-[2-(3-methoxyphenyl)acetyl]-2,8-diazaspiro[4.5]decan-2-yl]-2-oxoethyl]prop-2-enamide |
|---|---|
| PubChem CID | 3507631 |
| Molecular Formula | C26H31N3O5 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | 3-(furan-2-yl)-N-[2-[8-[2-(3-methoxyphenyl)acetyl]-2,8-diazaspiro[4.5]decan-2-yl]-2-oxoethyl]prop-2-enamide |
| SMILES | COc1cccc(CC(=O)N2CCC3(CC2)CCN(C(=O)CNC(=O)C=Cc2ccco2)C3)c1 |
| InChI | InChI=1S/C26H31N3O5/c1-33-22-5-2-4-20(16-22)17-24(31)28-12-9-26(10-13-28)11-14-29(19-26)25(32)18-27-23(30)8-7-21-6-3-15-34-21/h2-8,15-16H,9-14,17-19H2,1H3,(H,27,30) |
| InChIKey | HSAUMOPJEGHVKJ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 92.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|