C16H24ClN3O3 — CID 119754913
2-(3-methoxyphenyl)-1-[4-[2-(methylamino)acetyl]piperazin-1-yl]ethanone;hydrochloride (PubChem CID 119754913) has the molecular formula C16H24ClN3O3 and a molecular weight of 341.84 g/mol. Its IUPAC name is 2-(3-methoxyphenyl)-1-[4-[2-(methylamino)acetyl]piperazin-1-yl]ethanone;hydrochloride.
| Compound Name | 2-(3-methoxyphenyl)-1-[4-[2-(methylamino)acetyl]piperazin-1-yl]ethanone;hydrochloride |
|---|---|
| PubChem CID | 119754913 |
| Molecular Formula | C16H24ClN3O3 |
| Molecular Weight | 341.84 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 2-(3-methoxyphenyl)-1-[4-[2-(methylamino)acetyl]piperazin-1-yl]ethanone;hydrochloride |
| SMILES | CNCC(=O)N1CCN(C(=O)Cc2cccc(OC)c2)CC1.Cl |
| InChI | InChI=1S/C16H23N3O3.ClH/c1-17-12-16(21)19-8-6-18(7-9-19)15(20)11-13-4-3-5-14(10-13)22-2;/h3-5,10,17H,6-9,11-12H2,1-2H3;1H |
| InChIKey | QWKFDMITKZILGH-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.84 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |