C17H26ClN3O3 — CID 119306920
4-amino-1-[4-[2-(3-methoxyphenyl)acetyl]piperazin-1-yl]butan-1-one;hydrochloride (PubChem CID 119306920) has the molecular formula C17H26ClN3O3 and a molecular weight of 355.87 g/mol. Its IUPAC name is 4-amino-1-[4-[2-(3-methoxyphenyl)acetyl]piperazin-1-yl]butan-1-one;hydrochloride.
| Compound Name | 4-amino-1-[4-[2-(3-methoxyphenyl)acetyl]piperazin-1-yl]butan-1-one;hydrochloride |
|---|---|
| PubChem CID | 119306920 |
| Molecular Formula | C17H26ClN3O3 |
| Molecular Weight | 355.87 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | 4-amino-1-[4-[2-(3-methoxyphenyl)acetyl]piperazin-1-yl]butan-1-one;hydrochloride |
| SMILES | COc1cccc(CC(=O)N2CCN(C(=O)CCCN)CC2)c1.Cl |
| InChI | InChI=1S/C17H25N3O3.ClH/c1-23-15-5-2-4-14(12-15)13-17(22)20-10-8-19(9-11-20)16(21)6-3-7-18;/h2,4-5,12H,3,6-11,13,18H2,1H3;1H |
| InChIKey | YPCPGOMQXJBEAW-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.87 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |