C15H19N3O2 — CID 47439819
2-[4-[2-(3-methoxyphenyl)acetyl]piperazin-1-yl]acetonitrile (PubChem CID 47439819) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is 2-[4-[2-(3-methoxyphenyl)acetyl]piperazin-1-yl]acetonitrile.
| Compound Name | 2-[4-[2-(3-methoxyphenyl)acetyl]piperazin-1-yl]acetonitrile |
|---|---|
| PubChem CID | 47439819 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 2-[4-[2-(3-methoxyphenyl)acetyl]piperazin-1-yl]acetonitrile |
| SMILES | COc1cccc(CC(=O)N2CCN(CC#N)CC2)c1 |
| InChI | InChI=1S/C15H19N3O2/c1-20-14-4-2-3-13(11-14)12-15(19)18-9-7-17(6-5-16)8-10-18/h2-4,11H,6-10,12H2,1H3 |
| InChIKey | MSTDASRNDGSSMO-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|