C17H26N2O2 — CID 56822423
2-(3-methoxyphenyl)-1-(4-propyl-1,4-diazepan-1-yl)ethanone (PubChem CID 56822423) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is 2-(3-methoxyphenyl)-1-(4-propyl-1,4-diazepan-1-yl)ethanone.
| Compound Name | 2-(3-methoxyphenyl)-1-(4-propyl-1,4-diazepan-1-yl)ethanone |
|---|---|
| PubChem CID | 56822423 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | 2-(3-methoxyphenyl)-1-(4-propyl-1,4-diazepan-1-yl)ethanone |
| SMILES | CCCN1CCCN(C(=O)Cc2cccc(OC)c2)CC1 |
| InChI | InChI=1S/C17H26N2O2/c1-3-8-18-9-5-10-19(12-11-18)17(20)14-15-6-4-7-16(13-15)21-2/h4,6-7,13H,3,5,8-12,14H2,1-2H3 |
| InChIKey | FUEWEZHZCIQOOU-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |