C16H24N2O4S — CID 110799563
1-(4-ethylsulfonyl-1,4-diazepan-1-yl)-2-(3-methoxyphenyl)ethanone (PubChem CID 110799563) has the molecular formula C16H24N2O4S and a molecular weight of 340.44 g/mol. Its IUPAC name is 1-(4-ethylsulfonyl-1,4-diazepan-1-yl)-2-(3-methoxyphenyl)ethanone.
| Compound Name | 1-(4-ethylsulfonyl-1,4-diazepan-1-yl)-2-(3-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 110799563 |
| Molecular Formula | C16H24N2O4S |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 1-(4-ethylsulfonyl-1,4-diazepan-1-yl)-2-(3-methoxyphenyl)ethanone |
| SMILES | CCS(=O)(=O)N1CCCN(C(=O)Cc2cccc(OC)c2)CC1 |
| InChI | InChI=1S/C16H24N2O4S/c1-3-23(20,21)18-9-5-8-17(10-11-18)16(19)13-14-6-4-7-15(12-14)22-2/h4,6-7,12H,3,5,8-11,13H2,1-2H3 |
| InChIKey | DMMNELKIALDJTG-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |