C18H28N2O3S — CID 110799532
1-(4-butylsulfonyl-1,4-diazepan-1-yl)-2-(3-methylphenyl)ethanone (PubChem CID 110799532) has the molecular formula C18H28N2O3S and a molecular weight of 352.50 g/mol. Its IUPAC name is 1-(4-butylsulfonyl-1,4-diazepan-1-yl)-2-(3-methylphenyl)ethanone.
| Compound Name | 1-(4-butylsulfonyl-1,4-diazepan-1-yl)-2-(3-methylphenyl)ethanone |
|---|---|
| PubChem CID | 110799532 |
| Molecular Formula | C18H28N2O3S |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 1-(4-butylsulfonyl-1,4-diazepan-1-yl)-2-(3-methylphenyl)ethanone |
| SMILES | CCCCS(=O)(=O)N1CCCN(C(=O)Cc2cccc(C)c2)CC1 |
| InChI | InChI=1S/C18H28N2O3S/c1-3-4-13-24(22,23)20-10-6-9-19(11-12-20)18(21)15-17-8-5-7-16(2)14-17/h5,7-8,14H,3-4,6,9-13,15H2,1-2H3 |
| InChIKey | ZQDMXNXBDCJQCX-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |