C18H27FN2O3S — CID 110799511
1-(4-butylsulfonyl-1,4-diazepan-1-yl)-3-(3-fluorophenyl)propan-1-one (PubChem CID 110799511) has the molecular formula C18H27FN2O3S and a molecular weight of 370.49 g/mol. Its IUPAC name is 1-(4-butylsulfonyl-1,4-diazepan-1-yl)-3-(3-fluorophenyl)propan-1-one.
| Compound Name | 1-(4-butylsulfonyl-1,4-diazepan-1-yl)-3-(3-fluorophenyl)propan-1-one |
|---|---|
| PubChem CID | 110799511 |
| Molecular Formula | C18H27FN2O3S |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 1-(4-butylsulfonyl-1,4-diazepan-1-yl)-3-(3-fluorophenyl)propan-1-one |
| SMILES | CCCCS(=O)(=O)N1CCCN(C(=O)CCc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C18H27FN2O3S/c1-2-3-14-25(23,24)21-11-5-10-20(12-13-21)18(22)9-8-16-6-4-7-17(19)15-16/h4,6-7,15H,2-3,5,8-14H2,1H3 |
| InChIKey | UZAPFOHEHVPQDJ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |