C16H26ClN3O2 — CID 120704346
1-[4-[1-(3-methoxyphenyl)ethyl]piperazin-1-yl]-2-(methylamino)ethanone;hydrochloride (PubChem CID 120704346) has the molecular formula C16H26ClN3O2 and a molecular weight of 327.86 g/mol. Its IUPAC name is 1-[4-[1-(3-methoxyphenyl)ethyl]piperazin-1-yl]-2-(methylamino)ethanone;hydrochloride.
| Compound Name | 1-[4-[1-(3-methoxyphenyl)ethyl]piperazin-1-yl]-2-(methylamino)ethanone;hydrochloride |
|---|---|
| PubChem CID | 120704346 |
| Molecular Formula | C16H26ClN3O2 |
| Molecular Weight | 327.86 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | 1-[4-[1-(3-methoxyphenyl)ethyl]piperazin-1-yl]-2-(methylamino)ethanone;hydrochloride |
| SMILES | CNCC(=O)N1CCN(C(C)c2cccc(OC)c2)CC1.Cl |
| InChI | InChI=1S/C16H25N3O2.ClH/c1-13(14-5-4-6-15(11-14)21-3)18-7-9-19(10-8-18)16(20)12-17-2;/h4-6,11,13,17H,7-10,12H2,1-3H3;1H |
| InChIKey | ARJWOQRSNZUEMA-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.86 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |