C22H30N2O5 — CID 171914852
7-[2-[4-[(dimethylamino)methyl]-4-(hydroxymethyl)piperidin-1-yl]-2-oxoethoxy]-4-ethylchromen-2-one (PubChem CID 171914852) has the molecular formula C22H30N2O5 and a molecular weight of 402.49 g/mol. Its IUPAC name is 7-[2-[4-[(dimethylamino)methyl]-4-(hydroxymethyl)piperidin-1-yl]-2-oxoethoxy]-4-ethylchromen-2-one.
| Compound Name | 7-[2-[4-[(dimethylamino)methyl]-4-(hydroxymethyl)piperidin-1-yl]-2-oxoethoxy]-4-ethylchromen-2-one |
|---|---|
| PubChem CID | 171914852 |
| Molecular Formula | C22H30N2O5 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | 7-[2-[4-[(dimethylamino)methyl]-4-(hydroxymethyl)piperidin-1-yl]-2-oxoethoxy]-4-ethylchromen-2-one |
| SMILES | CCc1cc(=O)oc2cc(OCC(=O)N3CCC(CO)(CN(C)C)CC3)ccc12 |
| InChI | InChI=1S/C22H30N2O5/c1-4-16-11-21(27)29-19-12-17(5-6-18(16)19)28-13-20(26)24-9-7-22(15-25,8-10-24)14-23(2)3/h5-6,11-12,25H,4,7-10,13-15H2,1-3H3 |
| InChIKey | VVVBNTJVXXAREB-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|