C18H19F2NO4 — CID 171910311
7-[1-(3,3-difluoropyrrolidin-1-yl)-1-oxopropan-2-yl]oxy-4-ethylchromen-2-one (PubChem CID 171910311) has the molecular formula C18H19F2NO4 and a molecular weight of 351.35 g/mol. Its IUPAC name is 7-[1-(3,3-difluoropyrrolidin-1-yl)-1-oxopropan-2-yl]oxy-4-ethylchromen-2-one.
| Compound Name | 7-[1-(3,3-difluoropyrrolidin-1-yl)-1-oxopropan-2-yl]oxy-4-ethylchromen-2-one |
|---|---|
| PubChem CID | 171910311 |
| Molecular Formula | C18H19F2NO4 |
| Molecular Weight | 351.35 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 7-[1-(3,3-difluoropyrrolidin-1-yl)-1-oxopropan-2-yl]oxy-4-ethylchromen-2-one |
| SMILES | CCc1cc(=O)oc2cc(OC(C)C(=O)N3CCC(F)(F)C3)ccc12 |
| InChI | InChI=1S/C18H19F2NO4/c1-3-12-8-16(22)25-15-9-13(4-5-14(12)15)24-11(2)17(23)21-7-6-18(19,20)10-21/h4-5,8-9,11H,3,6-7,10H2,1-2H3 |
| InChIKey | DMZYXHFNILGMOE-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.35 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|