C23H28N2O5 — CID 171907016
8-[2-(4-ethyl-2-oxochromen-7-yl)oxypropanoyl]-1-methyl-1,8-diazaspiro[4.5]decan-2-one (PubChem CID 171907016) has the molecular formula C23H28N2O5 and a molecular weight of 412.49 g/mol. Its IUPAC name is 8-[2-(4-ethyl-2-oxochromen-7-yl)oxypropanoyl]-1-methyl-1,8-diazaspiro[4.5]decan-2-one.
| Compound Name | 8-[2-(4-ethyl-2-oxochromen-7-yl)oxypropanoyl]-1-methyl-1,8-diazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 171907016 |
| Molecular Formula | C23H28N2O5 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | 8-[2-(4-ethyl-2-oxochromen-7-yl)oxypropanoyl]-1-methyl-1,8-diazaspiro[4.5]decan-2-one |
| SMILES | CCc1cc(=O)oc2cc(OC(C)C(=O)N3CCC4(CCC(=O)N4C)CC3)ccc12 |
| InChI | InChI=1S/C23H28N2O5/c1-4-16-13-21(27)30-19-14-17(5-6-18(16)19)29-15(2)22(28)25-11-9-23(10-12-25)8-7-20(26)24(23)3/h5-6,13-15H,4,7-12H2,1-3H3 |
| InChIKey | VGHQCKCFTYNNJL-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|